C24H22ClN5O6S — CID 123774290
(1-carbamoylpiperidin-3-yl) 5-(4-chlorophenyl)-3-[(4-nitrophenyl)carbamoylamino]thiophene-2-carboxylate (PubChem CID 123774290) has the molecular formula C24H22ClN5O6S and a molecular weight of 543.99 g/mol. Its IUPAC name is (1-carbamoylpiperidin-3-yl) 5-(4-chlorophenyl)-3-[(4-nitrophenyl)carbamoylamino]thiophene-2-carboxylate.
| Compound Name | (1-carbamoylpiperidin-3-yl) 5-(4-chlorophenyl)-3-[(4-nitrophenyl)carbamoylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 123774290 |
| Molecular Formula | C24H22ClN5O6S |
| Molecular Weight | 543.99 g/mol |
| Exact Mass | 543.10 |
| IUPAC Name | (1-carbamoylpiperidin-3-yl) 5-(4-chlorophenyl)-3-[(4-nitrophenyl)carbamoylamino]thiophene-2-carboxylate |
| SMILES | NC(=O)N1CCCC(OC(=O)c2sc(-c3ccc(Cl)cc3)cc2NC(=O)Nc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C24H22ClN5O6S/c25-15-5-3-14(4-6-15)20-12-19(28-24(33)27-16-7-9-17(10-8-16)30(34)35)21(37-20)22(31)36-18-2-1-11-29(13-18)23(26)32/h3-10,12,18H,1-2,11,13H2,(H2,26,32)(H2,27,28,33) |
| InChIKey | WVEULNGUXMBKRF-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 156.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.99 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|