C16H18N4O5S — CID 123147845
(1-carbamoylpiperidin-3-yl) 3-(carbamoylamino)-5-(furan-3-yl)thiophene-2-carboxylate (PubChem CID 123147845) has the molecular formula C16H18N4O5S and a molecular weight of 378.41 g/mol. Its IUPAC name is (1-carbamoylpiperidin-3-yl) 3-(carbamoylamino)-5-(furan-3-yl)thiophene-2-carboxylate.
| Compound Name | (1-carbamoylpiperidin-3-yl) 3-(carbamoylamino)-5-(furan-3-yl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 123147845 |
| Molecular Formula | C16H18N4O5S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | (1-carbamoylpiperidin-3-yl) 3-(carbamoylamino)-5-(furan-3-yl)thiophene-2-carboxylate |
| SMILES | NC(=O)Nc1cc(-c2ccoc2)sc1C(=O)OC1CCCN(C(N)=O)C1 |
| InChI | InChI=1S/C16H18N4O5S/c17-15(22)19-11-6-12(9-3-5-24-8-9)26-13(11)14(21)25-10-2-1-4-20(7-10)16(18)23/h3,5-6,8,10H,1-2,4,7H2,(H2,18,23)(H3,17,19,22) |
| InChIKey | FEWKDUJRJQBEOK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 140.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |