C16H18ClN5O — CID 167891867
3-[[6-(3-chlorophenyl)pyrimidin-4-yl]amino]piperidine-1-carboxamide (PubChem CID 167891867) has the molecular formula C16H18ClN5O and a molecular weight of 331.81 g/mol. Its IUPAC name is 3-[[6-(3-chlorophenyl)pyrimidin-4-yl]amino]piperidine-1-carboxamide.
| Compound Name | 3-[[6-(3-chlorophenyl)pyrimidin-4-yl]amino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 167891867 |
| Molecular Formula | C16H18ClN5O |
| Molecular Weight | 331.81 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 3-[[6-(3-chlorophenyl)pyrimidin-4-yl]amino]piperidine-1-carboxamide |
| SMILES | NC(=O)N1CCCC(Nc2cc(-c3cccc(Cl)c3)ncn2)C1 |
| InChI | InChI=1S/C16H18ClN5O/c17-12-4-1-3-11(7-12)14-8-15(20-10-19-14)21-13-5-2-6-22(9-13)16(18)23/h1,3-4,7-8,10,13H,2,5-6,9H2,(H2,18,23)(H,19,20,21) |
| InChIKey | VPHSVHACZYYOJN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.81 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |