C17H19N3O2S — CID 69301770
(4-pyridin-3-ylthiophen-2-yl) N-(1-azabicyclo[2.2.2]octan-3-yl)carbamate (PubChem CID 69301770) has the molecular formula C17H19N3O2S and a molecular weight of 329.42 g/mol. Its IUPAC name is (4-pyridin-3-ylthiophen-2-yl) N-(1-azabicyclo[2.2.2]octan-3-yl)carbamate.
| Compound Name | (4-pyridin-3-ylthiophen-2-yl) N-(1-azabicyclo[2.2.2]octan-3-yl)carbamate |
|---|---|
| PubChem CID | 69301770 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | (4-pyridin-3-ylthiophen-2-yl) N-(1-azabicyclo[2.2.2]octan-3-yl)carbamate |
| SMILES | O=C(NC1CN2CCC1CC2)Oc1cc(-c2cccnc2)cs1 |
| InChI | InChI=1S/C17H19N3O2S/c21-17(19-15-10-20-6-3-12(15)4-7-20)22-16-8-14(11-23-16)13-2-1-5-18-9-13/h1-2,5,8-9,11-12,15H,3-4,6-7,10H2,(H,19,21) |
| InChIKey | WYKSCUZSPOHNHW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |