C12H14N4O — CID 21083403
N-[(4S)-1-azabicyclo[2.2.1]heptan-3-yl]-3-cyanopyrrole-1-carboxamide (PubChem CID 21083403) has the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. Its IUPAC name is N-[(4S)-1-azabicyclo[2.2.1]heptan-3-yl]-3-cyanopyrrole-1-carboxamide.
| Compound Name | N-[(4S)-1-azabicyclo[2.2.1]heptan-3-yl]-3-cyanopyrrole-1-carboxamide |
|---|---|
| PubChem CID | 21083403 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | N-[(4S)-1-azabicyclo[2.2.1]heptan-3-yl]-3-cyanopyrrole-1-carboxamide |
| SMILES | N#Cc1ccn(C(=O)NC2CN3CC[C@H]2C3)c1 |
| InChI | InChI=1S/C12H14N4O/c13-5-9-1-4-16(6-9)12(17)14-11-8-15-3-2-10(11)7-15/h1,4,6,10-11H,2-3,7-8H2,(H,14,17)/t10-,11?/m0/s1 |
| InChIKey | QHYRNTDIULZEBC-VUWPPUDQSA-N |
| XLogP | 0.62 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |