C22H19N3O2 — CID 91221146
N-[(4S)-1-azabicyclo[2.2.1]heptan-3-yl]-3-(2-phenylethynyl)furo[2,3-c]pyridine-7-carboxamide (PubChem CID 91221146) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[(4S)-1-azabicyclo[2.2.1]heptan-3-yl]-3-(2-phenylethynyl)furo[2,3-c]pyridine-7-carboxamide.
| Compound Name | N-[(4S)-1-azabicyclo[2.2.1]heptan-3-yl]-3-(2-phenylethynyl)furo[2,3-c]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 91221146 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[(4S)-1-azabicyclo[2.2.1]heptan-3-yl]-3-(2-phenylethynyl)furo[2,3-c]pyridine-7-carboxamide |
| SMILES | O=C(NC1CN2CC[C@H]1C2)c1nccc2c(C#Cc3ccccc3)coc12 |
| InChI | InChI=1S/C22H19N3O2/c26-22(24-19-13-25-11-9-16(19)12-25)20-21-18(8-10-23-20)17(14-27-21)7-6-15-4-2-1-3-5-15/h1-5,8,10,14,16,19H,9,11-13H2,(H,24,26)/t16-,19?/m0/s1 |
| InChIKey | VEYSDPZUGFPTJN-UCFFOFKASA-N |
| XLogP | 2.66 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|