C10H9F3INO — CID 21035206
2,2,2-trifluoro-N-[1-(4-iodophenyl)ethyl]acetamide (PubChem CID 21035206) has the molecular formula C10H9F3INO and a molecular weight of 343.09 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[1-(4-iodophenyl)ethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[1-(4-iodophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 21035206 |
| Molecular Formula | C10H9F3INO |
| Molecular Weight | 343.09 g/mol |
| Exact Mass | 342.97 |
| IUPAC Name | 2,2,2-trifluoro-N-[1-(4-iodophenyl)ethyl]acetamide |
| SMILES | CC(NC(=O)C(F)(F)F)c1ccc(I)cc1 |
| InChI | InChI=1S/C10H9F3INO/c1-6(15-9(16)10(11,12)13)7-2-4-8(14)5-3-7/h2-6H,1H3,(H,15,16) |
| InChIKey | HFPLOJKMTNAYBB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.09 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|