C16H13ClF3NO3S — CID 58651376
N-[(1S)-1-[4-(4-chlorophenyl)sulfonylphenyl]ethyl]-2,2,2-trifluoroacetamide (PubChem CID 58651376) has the molecular formula C16H13ClF3NO3S and a molecular weight of 391.80 g/mol. Its IUPAC name is N-[(1S)-1-[4-(4-chlorophenyl)sulfonylphenyl]ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1S)-1-[4-(4-chlorophenyl)sulfonylphenyl]ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 58651376 |
| Molecular Formula | C16H13ClF3NO3S |
| Molecular Weight | 391.80 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | N-[(1S)-1-[4-(4-chlorophenyl)sulfonylphenyl]ethyl]-2,2,2-trifluoroacetamide |
| SMILES | C[C@H](NC(=O)C(F)(F)F)c1ccc(S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H13ClF3NO3S/c1-10(21-15(22)16(18,19)20)11-2-6-13(7-3-11)25(23,24)14-8-4-12(17)5-9-14/h2-10H,1H3,(H,21,22)/t10-/m0/s1 |
| InChIKey | NKLBLTRASRTFKC-JTQLQIEISA-N |
| XLogP | 3.91 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.80 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |