C23H29F2N3O4 — CID 21042767
4,4-difluoro-1-[2-hydroxy-3-(pent-4-ynoylamino)-4-phenylbutanoyl]-N-propylpyrrolidine-2-carboxamide (PubChem CID 21042767) has the molecular formula C23H29F2N3O4 and a molecular weight of 449.50 g/mol. Its IUPAC name is 4,4-difluoro-1-[2-hydroxy-3-(pent-4-ynoylamino)-4-phenylbutanoyl]-N-propylpyrrolidine-2-carboxamide.
| Compound Name | 4,4-difluoro-1-[2-hydroxy-3-(pent-4-ynoylamino)-4-phenylbutanoyl]-N-propylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 21042767 |
| Molecular Formula | C23H29F2N3O4 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 4,4-difluoro-1-[2-hydroxy-3-(pent-4-ynoylamino)-4-phenylbutanoyl]-N-propylpyrrolidine-2-carboxamide |
| SMILES | C#CCCC(=O)NC(Cc1ccccc1)C(O)C(=O)N1CC(F)(F)CC1C(=O)NCCC |
| InChI | InChI=1S/C23H29F2N3O4/c1-3-5-11-19(29)27-17(13-16-9-7-6-8-10-16)20(30)22(32)28-15-23(24,25)14-18(28)21(31)26-12-4-2/h1,6-10,17-18,20,30H,4-5,11-15H2,2H3,(H,26,31)(H,27,29) |
| InChIKey | DFCDHWQMUHLVGF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|