C23H27F2N3O4 — CID 89373343
(2S)-4,4-difluoro-1-[(2S,3S)-2-hydroxy-3-(pent-4-ynoylamino)-4-phenylbutanoyl]-N-prop-2-enylpyrrolidine-2-carboxamide (PubChem CID 89373343) has the molecular formula C23H27F2N3O4 and a molecular weight of 447.48 g/mol. Its IUPAC name is (2S)-4,4-difluoro-1-[(2S,3S)-2-hydroxy-3-(pent-4-ynoylamino)-4-phenylbutanoyl]-N-prop-2-enylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-4,4-difluoro-1-[(2S,3S)-2-hydroxy-3-(pent-4-ynoylamino)-4-phenylbutanoyl]-N-prop-2-enylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 89373343 |
| Molecular Formula | C23H27F2N3O4 |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (2S)-4,4-difluoro-1-[(2S,3S)-2-hydroxy-3-(pent-4-ynoylamino)-4-phenylbutanoyl]-N-prop-2-enylpyrrolidine-2-carboxamide |
| SMILES | C#CCCC(=O)N[C@@H](Cc1ccccc1)[C@H](O)C(=O)N1CC(F)(F)C[C@H]1C(=O)NCC=C |
| InChI | InChI=1S/C23H27F2N3O4/c1-3-5-11-19(29)27-17(13-16-9-7-6-8-10-16)20(30)22(32)28-15-23(24,25)14-18(28)21(31)26-12-4-2/h1,4,6-10,17-18,20,30H,2,5,11-15H2,(H,26,31)(H,27,29)/t17-,18-,20-/m0/s1 |
| InChIKey | DRLSDMJJBMVRAV-BJLQDIEVSA-N |
| XLogP | 1.03 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|