C27H20F6N2O2S2 — CID 21044735
5-[3,3,4,4,5,5-hexafluoro-2-[2-(4-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]cyclopenten-1-yl]-2-(4-methoxyphenyl)-4-methyl-1,3-thiazole (PubChem CID 21044735) has the molecular formula C27H20F6N2O2S2 and a molecular weight of 582.59 g/mol. Its IUPAC name is 5-[3,3,4,4,5,5-hexafluoro-2-[2-(4-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]cyclopenten-1-yl]-2-(4-methoxyphenyl)-4-methyl-1,3-thiazole.
| Compound Name | 5-[3,3,4,4,5,5-hexafluoro-2-[2-(4-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]cyclopenten-1-yl]-2-(4-methoxyphenyl)-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 21044735 |
| Molecular Formula | C27H20F6N2O2S2 |
| Molecular Weight | 582.59 g/mol |
| Exact Mass | 582.09 |
| IUPAC Name | 5-[3,3,4,4,5,5-hexafluoro-2-[2-(4-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]cyclopenten-1-yl]-2-(4-methoxyphenyl)-4-methyl-1,3-thiazole |
| SMILES | COc1ccc(-c2nc(C)c(C3=C(c4sc(-c5ccc(OC)cc5)nc4C)C(F)(F)C(F)(F)C3(F)F)s2)cc1 |
| InChI | InChI=1S/C27H20F6N2O2S2/c1-13-21(38-23(34-13)15-5-9-17(36-3)10-6-15)19-20(26(30,31)27(32,33)25(19,28)29)22-14(2)35-24(39-22)16-7-11-18(37-4)12-8-16/h5-12H,1-4H3 |
| InChIKey | NDFODZKMISFWTB-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.59 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|