C14H9F2NOS — CID 11514632
5-fluoro-2-(3-fluoro-4-methoxyphenyl)-1,3-benzothiazole (PubChem CID 11514632) has the molecular formula C14H9F2NOS and a molecular weight of 277.30 g/mol. Its IUPAC name is 5-fluoro-2-(3-fluoro-4-methoxyphenyl)-1,3-benzothiazole.
| Compound Name | 5-fluoro-2-(3-fluoro-4-methoxyphenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 11514632 |
| Molecular Formula | C14H9F2NOS |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 5-fluoro-2-(3-fluoro-4-methoxyphenyl)-1,3-benzothiazole |
| SMILES | COc1ccc(-c2nc3cc(F)ccc3s2)cc1F |
| InChI | InChI=1S/C14H9F2NOS/c1-18-12-4-2-8(6-10(12)16)14-17-11-7-9(15)3-5-13(11)19-14/h2-7H,1H3 |
| InChIKey | AKYOAPWAMYKBLL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |