C14H10F2N2S — CID 134517914
2-fluoro-4-(5-fluoro-1,3-benzothiazol-2-yl)-6-methylaniline (PubChem CID 134517914) has the molecular formula C14H10F2N2S and a molecular weight of 276.31 g/mol. Its IUPAC name is 2-fluoro-4-(5-fluoro-1,3-benzothiazol-2-yl)-6-methylaniline.
| Compound Name | 2-fluoro-4-(5-fluoro-1,3-benzothiazol-2-yl)-6-methylaniline |
|---|---|
| PubChem CID | 134517914 |
| Molecular Formula | C14H10F2N2S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 2-fluoro-4-(5-fluoro-1,3-benzothiazol-2-yl)-6-methylaniline |
| SMILES | Cc1cc(-c2nc3cc(F)ccc3s2)cc(F)c1N |
| InChI | InChI=1S/C14H10F2N2S/c1-7-4-8(5-10(16)13(7)17)14-18-11-6-9(15)2-3-12(11)19-14/h2-6H,17H2,1H3 |
| InChIKey | ICIAAKKSNZNTKQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|