C15H13FN2O2S — CID 43305621
2-(5-fluoro-1,3-benzothiazol-2-yl)-4,5-dimethoxyaniline (PubChem CID 43305621) has the molecular formula C15H13FN2O2S and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-(5-fluoro-1,3-benzothiazol-2-yl)-4,5-dimethoxyaniline.
| Compound Name | 2-(5-fluoro-1,3-benzothiazol-2-yl)-4,5-dimethoxyaniline |
|---|---|
| PubChem CID | 43305621 |
| Molecular Formula | C15H13FN2O2S |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 2-(5-fluoro-1,3-benzothiazol-2-yl)-4,5-dimethoxyaniline |
| SMILES | COc1cc(N)c(-c2nc3cc(F)ccc3s2)cc1OC |
| InChI | InChI=1S/C15H13FN2O2S/c1-19-12-6-9(10(17)7-13(12)20-2)15-18-11-5-8(16)3-4-14(11)21-15/h3-7H,17H2,1-2H3 |
| InChIKey | JWGMESBOACYSDN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|