C29H16F6N2S2 — CID 21044742
2-[3,3,4,4,5,5-hexafluoro-2-(3-methylthieno[3,2-g]quinolin-2-yl)cyclopenten-1-yl]-3-methylthieno[3,2-g]quinoline (PubChem CID 21044742) has the molecular formula C29H16F6N2S2 and a molecular weight of 570.58 g/mol. Its IUPAC name is 2-[3,3,4,4,5,5-hexafluoro-2-(3-methylthieno[3,2-g]quinolin-2-yl)cyclopenten-1-yl]-3-methylthieno[3,2-g]quinoline.
| Compound Name | 2-[3,3,4,4,5,5-hexafluoro-2-(3-methylthieno[3,2-g]quinolin-2-yl)cyclopenten-1-yl]-3-methylthieno[3,2-g]quinoline |
|---|---|
| PubChem CID | 21044742 |
| Molecular Formula | C29H16F6N2S2 |
| Molecular Weight | 570.58 g/mol |
| Exact Mass | 570.07 |
| IUPAC Name | 2-[3,3,4,4,5,5-hexafluoro-2-(3-methylthieno[3,2-g]quinolin-2-yl)cyclopenten-1-yl]-3-methylthieno[3,2-g]quinoline |
| SMILES | Cc1c(C2=C(c3sc4cc5ncccc5cc4c3C)C(F)(F)C(F)(F)C2(F)F)sc2cc3ncccc3cc12 |
| InChI | InChI=1S/C29H16F6N2S2/c1-13-17-9-15-5-3-7-36-19(15)11-21(17)38-25(13)23-24(28(32,33)29(34,35)27(23,30)31)26-14(2)18-10-16-6-4-8-37-20(16)12-22(18)39-26/h3-12H,1-2H3 |
| InChIKey | LZANLJYLJFTVBA-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.58 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|