C23H24N2O2S — CID 21046084
5-[(2,6-dimethylphenyl)sulfanylmethyl]-N-(1-pyridin-4-ylbut-3-enyl)furan-2-carboxamide (PubChem CID 21046084) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is 5-[(2,6-dimethylphenyl)sulfanylmethyl]-N-(1-pyridin-4-ylbut-3-enyl)furan-2-carboxamide.
| Compound Name | 5-[(2,6-dimethylphenyl)sulfanylmethyl]-N-(1-pyridin-4-ylbut-3-enyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 21046084 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 5-[(2,6-dimethylphenyl)sulfanylmethyl]-N-(1-pyridin-4-ylbut-3-enyl)furan-2-carboxamide |
| SMILES | C=CCC(NC(=O)c1ccc(CSc2c(C)cccc2C)o1)c1ccncc1 |
| InChI | InChI=1S/C23H24N2O2S/c1-4-6-20(18-11-13-24-14-12-18)25-23(26)21-10-9-19(27-21)15-28-22-16(2)7-5-8-17(22)3/h4-5,7-14,20H,1,6,15H2,2-3H3,(H,25,26) |
| InChIKey | GWNOAIXKEITKGJ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|