C29H34N2O3 — CID 21045872
5-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)methyl]-N-(1-pyridin-4-ylbut-3-enyl)furan-2-carboxamide (PubChem CID 21045872) has the molecular formula C29H34N2O3 and a molecular weight of 458.60 g/mol. Its IUPAC name is 5-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)methyl]-N-(1-pyridin-4-ylbut-3-enyl)furan-2-carboxamide.
| Compound Name | 5-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)methyl]-N-(1-pyridin-4-ylbut-3-enyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 21045872 |
| Molecular Formula | C29H34N2O3 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 5-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)methyl]-N-(1-pyridin-4-ylbut-3-enyl)furan-2-carboxamide |
| SMILES | C=CCC(NC(=O)c1ccc(Cc2c(C)c(C)c3c(c2C)CCC(C)(C)O3)o1)c1ccncc1 |
| InChI | InChI=1S/C29H34N2O3/c1-7-8-25(21-12-15-30-16-13-21)31-28(32)26-10-9-22(33-26)17-24-18(2)19(3)27-23(20(24)4)11-14-29(5,6)34-27/h7,9-10,12-13,15-16,25H,1,8,11,14,17H2,2-6H3,(H,31,32) |
| InChIKey | KTVRSZDWYFOEPO-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|