C29H35NO5 — CID 21047604
N-[(3,5-dimethoxyphenyl)methyl]-5-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)methyl]furan-2-carboxamide (PubChem CID 21047604) has the molecular formula C29H35NO5 and a molecular weight of 477.60 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)methyl]-5-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[(3,5-dimethoxyphenyl)methyl]-5-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21047604 |
| Molecular Formula | C29H35NO5 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)methyl]-5-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)methyl]furan-2-carboxamide |
| SMILES | COc1cc(CNC(=O)c2ccc(Cc3c(C)c(C)c4c(c3C)CCC(C)(C)O4)o2)cc(OC)c1 |
| InChI | InChI=1S/C29H35NO5/c1-17-18(2)27-24(10-11-29(4,5)35-27)19(3)25(17)15-21-8-9-26(34-21)28(31)30-16-20-12-22(32-6)14-23(13-20)33-7/h8-9,12-14H,10-11,15-16H2,1-7H3,(H,30,31) |
| InChIKey | IAGNFULRMHFEQM-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |