C24H27NO4 — CID 21046251
N-[2-(2-methoxyphenyl)ethyl]-5-(2-methyl-5-propan-2-ylphenoxy)furan-2-carboxamide (PubChem CID 21046251) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is N-[2-(2-methoxyphenyl)ethyl]-5-(2-methyl-5-propan-2-ylphenoxy)furan-2-carboxamide.
| Compound Name | N-[2-(2-methoxyphenyl)ethyl]-5-(2-methyl-5-propan-2-ylphenoxy)furan-2-carboxamide |
|---|---|
| PubChem CID | 21046251 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | N-[2-(2-methoxyphenyl)ethyl]-5-(2-methyl-5-propan-2-ylphenoxy)furan-2-carboxamide |
| SMILES | COc1ccccc1CCNC(=O)c1ccc(Oc2cc(C(C)C)ccc2C)o1 |
| InChI | InChI=1S/C24H27NO4/c1-16(2)19-10-9-17(3)22(15-19)29-23-12-11-21(28-23)24(26)25-14-13-18-7-5-6-8-20(18)27-4/h5-12,15-16H,13-14H2,1-4H3,(H,25,26) |
| InChIKey | GGYLBOWWLFLOQW-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |