C27H31NO3 — CID 21046691
5-[(5-tert-butyl-2-methylphenyl)methyl]-N-[(1E)-1-(furan-2-yl)hexa-1,5-dien-3-yl]furan-2-carboxamide (PubChem CID 21046691) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is 5-[(5-tert-butyl-2-methylphenyl)methyl]-N-[(1E)-1-(furan-2-yl)hexa-1,5-dien-3-yl]furan-2-carboxamide.
| Compound Name | 5-[(5-tert-butyl-2-methylphenyl)methyl]-N-[(1E)-1-(furan-2-yl)hexa-1,5-dien-3-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21046691 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 5-[(5-tert-butyl-2-methylphenyl)methyl]-N-[(1E)-1-(furan-2-yl)hexa-1,5-dien-3-yl]furan-2-carboxamide |
| SMILES | C=CCC(/C=C/c1ccco1)NC(=O)c1ccc(Cc2cc(C(C)(C)C)ccc2C)o1 |
| InChI | InChI=1S/C27H31NO3/c1-6-8-22(12-13-23-9-7-16-30-23)28-26(29)25-15-14-24(31-25)18-20-17-21(27(3,4)5)11-10-19(20)2/h6-7,9-17,22H,1,8,18H2,2-5H3,(H,28,29)/b13-12+ |
| InChIKey | XZYODGXCXOGQQM-OUKQBFOZSA-N |
| XLogP | 6.46 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|