C27H28FN7O3S — CID 21050389
[4-fluoro-1-[(5-nitrothiophen-3-yl)methyl]piperidin-4-yl]-[4-(2-pyridin-2-ylimidazo[4,5-b]pyridin-3-yl)piperidin-1-yl]methanone (PubChem CID 21050389) has the molecular formula C27H28FN7O3S and a molecular weight of 549.63 g/mol. Its IUPAC name is [4-fluoro-1-[(5-nitrothiophen-3-yl)methyl]piperidin-4-yl]-[4-(2-pyridin-2-ylimidazo[4,5-b]pyridin-3-yl)piperidin-1-yl]methanone.
| Compound Name | [4-fluoro-1-[(5-nitrothiophen-3-yl)methyl]piperidin-4-yl]-[4-(2-pyridin-2-ylimidazo[4,5-b]pyridin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 21050389 |
| Molecular Formula | C27H28FN7O3S |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | [4-fluoro-1-[(5-nitrothiophen-3-yl)methyl]piperidin-4-yl]-[4-(2-pyridin-2-ylimidazo[4,5-b]pyridin-3-yl)piperidin-1-yl]methanone |
| SMILES | O=C(N1CCC(n2c(-c3ccccn3)nc3cccnc32)CC1)C1(F)CCN(Cc2csc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C27H28FN7O3S/c28-27(8-14-32(15-9-27)17-19-16-23(35(37)38)39-18-19)26(36)33-12-6-20(7-13-33)34-24-22(5-3-11-30-24)31-25(34)21-4-1-2-10-29-21/h1-5,10-11,16,18,20H,6-9,12-15,17H2 |
| InChIKey | JBMGPBTVUUPHNY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|