C23H30FN9OS — CID 71178145
[4-fluoro-1-[(2-hydrazinylpyrimidin-5-yl)methyl]piperidin-4-yl]-[4-(2-methylsulfanylimidazo[4,5-b]pyridin-3-yl)piperidin-1-yl]methanone (PubChem CID 71178145) has the molecular formula C23H30FN9OS and a molecular weight of 499.62 g/mol. Its IUPAC name is [4-fluoro-1-[(2-hydrazinylpyrimidin-5-yl)methyl]piperidin-4-yl]-[4-(2-methylsulfanylimidazo[4,5-b]pyridin-3-yl)piperidin-1-yl]methanone.
| Compound Name | [4-fluoro-1-[(2-hydrazinylpyrimidin-5-yl)methyl]piperidin-4-yl]-[4-(2-methylsulfanylimidazo[4,5-b]pyridin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 71178145 |
| Molecular Formula | C23H30FN9OS |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | [4-fluoro-1-[(2-hydrazinylpyrimidin-5-yl)methyl]piperidin-4-yl]-[4-(2-methylsulfanylimidazo[4,5-b]pyridin-3-yl)piperidin-1-yl]methanone |
| SMILES | CSc1nc2cccnc2n1C1CCN(C(=O)C2(F)CCN(Cc3cnc(NN)nc3)CC2)CC1 |
| InChI | InChI=1S/C23H30FN9OS/c1-35-22-29-18-3-2-8-26-19(18)33(22)17-4-9-32(10-5-17)20(34)23(24)6-11-31(12-7-23)15-16-13-27-21(30-25)28-14-16/h2-3,8,13-14,17H,4-7,9-12,15,25H2,1H3,(H,27,28,30) |
| InChIKey | YSEUOXLWYLHVIF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 118.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|