C60H73AlN4O3 — CID 21051683
N-[[8-di(quinolin-8-yloxy)alumanyloxyquinolin-5-yl]methyl]-6-[4-ethenyl-2-[3-(3-ethenyl-4-nonylcyclopentyl)propa-1,2-dienyl]cyclopentyl]hexan-1-amine (PubChem CID 21051683) has the molecular formula C60H73AlN4O3 and a molecular weight of 925.25 g/mol. Its IUPAC name is N-[[8-di(quinolin-8-yloxy)alumanyloxyquinolin-5-yl]methyl]-6-[4-ethenyl-2-[3-(3-ethenyl-4-nonylcyclopentyl)propa-1,2-dienyl]cyclopentyl]hexan-1-amine.
| Compound Name | N-[[8-di(quinolin-8-yloxy)alumanyloxyquinolin-5-yl]methyl]-6-[4-ethenyl-2-[3-(3-ethenyl-4-nonylcyclopentyl)propa-1,2-dienyl]cyclopentyl]hexan-1-amine |
|---|---|
| PubChem CID | 21051683 |
| Molecular Formula | C60H73AlN4O3 |
| Molecular Weight | 925.25 g/mol |
| Exact Mass | 924.55 |
| IUPAC Name | N-[[8-di(quinolin-8-yloxy)alumanyloxyquinolin-5-yl]methyl]-6-[4-ethenyl-2-[3-(3-ethenyl-4-nonylcyclopentyl)propa-1,2-dienyl]cyclopentyl]hexan-1-amine |
| SMILES | C=CC1CC(C=C=CC2CC(C=C)C(CCCCCCCCC)C2)C(CCCCCCNCc2ccc(O[Al](Oc3cccc4cccnc34)Oc3cccc4cccnc34)c3ncccc23)C1 |
| InChI | InChI=1S/C42H62N2O.2C9H7NO.Al/c1-4-7-8-9-10-11-14-20-36-31-34(30-35(36)6-3)19-17-22-38-29-33(5-2)28-37(38)21-15-12-13-16-26-43-32-39-24-25-41(45)42-40(39)23-18-27-44-42;2*11-8-5-1-3-7-4-2-6-10-9(7)8;/h5-6,18-19,22-25,27,33-38,43,45H,2-4,7-16,20-21,26,28-32H2,1H3;2*1-6,11H;/q;;;+3/p-3 |
| InChIKey | GRJYXUMBUBYWKU-UHFFFAOYSA-K |
| XLogP | 15.40 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.25 |
| LogP ≤ 5 | 15.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|