C33H25N5O5 — CID 21053732
[4-hydroxy-3-[(2-methylphenyl)carbamoyl]naphthalen-1-yl] 2-[benzotriazole-1-carbonyl(methyl)amino]benzoate (PubChem CID 21053732) has the molecular formula C33H25N5O5 and a molecular weight of 571.59 g/mol. Its IUPAC name is [4-hydroxy-3-[(2-methylphenyl)carbamoyl]naphthalen-1-yl] 2-[benzotriazole-1-carbonyl(methyl)amino]benzoate.
| Compound Name | [4-hydroxy-3-[(2-methylphenyl)carbamoyl]naphthalen-1-yl] 2-[benzotriazole-1-carbonyl(methyl)amino]benzoate |
|---|---|
| PubChem CID | 21053732 |
| Molecular Formula | C33H25N5O5 |
| Molecular Weight | 571.59 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | [4-hydroxy-3-[(2-methylphenyl)carbamoyl]naphthalen-1-yl] 2-[benzotriazole-1-carbonyl(methyl)amino]benzoate |
| SMILES | Cc1ccccc1NC(=O)c1cc(OC(=O)c2ccccc2N(C)C(=O)n2nnc3ccccc32)c2ccccc2c1O |
| InChI | InChI=1S/C33H25N5O5/c1-20-11-3-7-15-25(20)34-31(40)24-19-29(21-12-4-5-13-22(21)30(24)39)43-32(41)23-14-6-9-17-27(23)37(2)33(42)38-28-18-10-8-16-26(28)35-36-38/h3-19,39H,1-2H3,(H,34,40) |
| InChIKey | QROHIRIVABHFHQ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.59 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|