C14H11ClN4S — CID 21055056
1-[(E)-(4-chlorophenyl)methylideneamino]-4-thiophen-2-ylimidazol-2-amine (PubChem CID 21055056) has the molecular formula C14H11ClN4S and a molecular weight of 302.79 g/mol. Its IUPAC name is 1-[(E)-(4-chlorophenyl)methylideneamino]-4-thiophen-2-ylimidazol-2-amine.
| Compound Name | 1-[(E)-(4-chlorophenyl)methylideneamino]-4-thiophen-2-ylimidazol-2-amine |
|---|---|
| PubChem CID | 21055056 |
| Molecular Formula | C14H11ClN4S |
| Molecular Weight | 302.79 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 1-[(E)-(4-chlorophenyl)methylideneamino]-4-thiophen-2-ylimidazol-2-amine |
| SMILES | Nc1nc(-c2cccs2)cn1/N=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H11ClN4S/c15-11-5-3-10(4-6-11)8-17-19-9-12(18-14(19)16)13-2-1-7-20-13/h1-9H,(H2,16,18)/b17-8+ |
| InChIKey | QKGZSBSNFCVICS-CAOOACKPSA-N |
| XLogP | 3.73 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.79 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|