C14H12ClN5S — CID 46228717
1-[(E)-(4-chlorophenyl)methylideneamino]-5-methyl-4-(1,3-thiazol-2-yl)imidazol-2-amine (PubChem CID 46228717) has the molecular formula C14H12ClN5S and a molecular weight of 317.81 g/mol. Its IUPAC name is 1-[(E)-(4-chlorophenyl)methylideneamino]-5-methyl-4-(1,3-thiazol-2-yl)imidazol-2-amine.
| Compound Name | 1-[(E)-(4-chlorophenyl)methylideneamino]-5-methyl-4-(1,3-thiazol-2-yl)imidazol-2-amine |
|---|---|
| PubChem CID | 46228717 |
| Molecular Formula | C14H12ClN5S |
| Molecular Weight | 317.81 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 1-[(E)-(4-chlorophenyl)methylideneamino]-5-methyl-4-(1,3-thiazol-2-yl)imidazol-2-amine |
| SMILES | Cc1c(-c2nccs2)nc(N)n1/N=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H12ClN5S/c1-9-12(13-17-6-7-21-13)19-14(16)20(9)18-8-10-2-4-11(15)5-3-10/h2-8H,1H3,(H2,16,19)/b18-8+ |
| InChIKey | DODUVCSEDQJJQE-QGMBQPNBSA-N |
| XLogP | 3.43 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.81 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|