C20H16N2O3S2 — CID 21058801
4-[(5-methyl-4-naphthalen-2-yl-1,3-thiazol-2-yl)amino]benzenesulfonic acid (PubChem CID 21058801) has the molecular formula C20H16N2O3S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is 4-[(5-methyl-4-naphthalen-2-yl-1,3-thiazol-2-yl)amino]benzenesulfonic acid.
| Compound Name | 4-[(5-methyl-4-naphthalen-2-yl-1,3-thiazol-2-yl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 21058801 |
| Molecular Formula | C20H16N2O3S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 4-[(5-methyl-4-naphthalen-2-yl-1,3-thiazol-2-yl)amino]benzenesulfonic acid |
| SMILES | Cc1sc(Nc2ccc(S(=O)(=O)O)cc2)nc1-c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H16N2O3S2/c1-13-19(16-7-6-14-4-2-3-5-15(14)12-16)22-20(26-13)21-17-8-10-18(11-9-17)27(23,24)25/h2-12H,1H3,(H,21,22)(H,23,24,25) |
| InChIKey | XFCTXKSEUAPNSH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|