C17H17N3O4S2 — CID 164587766
4-[[4-(2,6-dimethyl-4-pyridinyl)-5-(hydroxymethyl)-1,3-thiazol-2-yl]amino]benzenesulfonic acid (PubChem CID 164587766) has the molecular formula C17H17N3O4S2 and a molecular weight of 391.47 g/mol. Its IUPAC name is 4-[[4-(2,6-dimethyl-4-pyridinyl)-5-(hydroxymethyl)-1,3-thiazol-2-yl]amino]benzenesulfonic acid.
| Compound Name | 4-[[4-(2,6-dimethyl-4-pyridinyl)-5-(hydroxymethyl)-1,3-thiazol-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 164587766 |
| Molecular Formula | C17H17N3O4S2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 4-[[4-(2,6-dimethyl-4-pyridinyl)-5-(hydroxymethyl)-1,3-thiazol-2-yl]amino]benzenesulfonic acid |
| SMILES | Cc1cc(-c2nc(Nc3ccc(S(=O)(=O)O)cc3)sc2CO)cc(C)n1 |
| InChI | InChI=1S/C17H17N3O4S2/c1-10-7-12(8-11(2)18-10)16-15(9-21)25-17(20-16)19-13-3-5-14(6-4-13)26(22,23)24/h3-8,21H,9H2,1-2H3,(H,19,20)(H,22,23,24) |
| InChIKey | QPWYNHARRUZCIU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|