C18H21N3OS — CID 143863469
ethane;[2-(3-methylanilino)-4-pyridin-4-yl-1,3-thiazol-5-yl]methanol (PubChem CID 143863469) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is ethane;[2-(3-methylanilino)-4-pyridin-4-yl-1,3-thiazol-5-yl]methanol.
| Compound Name | ethane;[2-(3-methylanilino)-4-pyridin-4-yl-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 143863469 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | ethane;[2-(3-methylanilino)-4-pyridin-4-yl-1,3-thiazol-5-yl]methanol |
| SMILES | CC.Cc1cccc(Nc2nc(-c3ccncc3)c(CO)s2)c1 |
| InChI | InChI=1S/C16H15N3OS.C2H6/c1-11-3-2-4-13(9-11)18-16-19-15(14(10-20)21-16)12-5-7-17-8-6-12;1-2/h2-9,20H,10H2,1H3,(H,18,19);1-2H3 |
| InChIKey | DMBCCXOTUNEURR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |