C18H17N3O2S — CID 44818114
3-[2-(3-methylanilino)-4-pyridin-4-yl-1,3-thiazol-5-yl]propanoic acid (PubChem CID 44818114) has the molecular formula C18H17N3O2S and a molecular weight of 339.42 g/mol. Its IUPAC name is 3-[2-(3-methylanilino)-4-pyridin-4-yl-1,3-thiazol-5-yl]propanoic acid.
| Compound Name | 3-[2-(3-methylanilino)-4-pyridin-4-yl-1,3-thiazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 44818114 |
| Molecular Formula | C18H17N3O2S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 3-[2-(3-methylanilino)-4-pyridin-4-yl-1,3-thiazol-5-yl]propanoic acid |
| SMILES | Cc1cccc(Nc2nc(-c3ccncc3)c(CCC(=O)O)s2)c1 |
| InChI | InChI=1S/C18H17N3O2S/c1-12-3-2-4-14(11-12)20-18-21-17(13-7-9-19-10-8-13)15(24-18)5-6-16(22)23/h2-4,7-11H,5-6H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | BBKWFRXVQDDIRA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |