About 4,5-dimethyl-2,5-dihydro-1,2-oxazole
4,5-dimethyl-2,5-dihydro-1,2-oxazole (PubChem CID 21059269) has the molecular formula C5H9NO
and a molecular weight of 99.13 g/mol. Its IUPAC name is 4,5-dimethyl-2,5-dihydro-1,2-oxazole.
Molecular Properties
| Compound Name | 4,5-dimethyl-2,5-dihydro-1,2-oxazole |
| PubChem CID | 21059269 |
| Molecular Formula | C5H9NO |
| Molecular Weight | 99.13 g/mol |
| Exact Mass | 99.07 |
| IUPAC Name | 4,5-dimethyl-2,5-dihydro-1,2-oxazole |
| SMILES | CC1=CNOC1C |
| InChI | InChI=1S/C5H9NO/c1-4-3-6-7-5(4)2/h3,5-6H,1-2H3 |
| InChIKey | DDAFDULAOIXPJJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.13 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-dimethyl-2,5-dihydro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-2,5-dihydro-1,2-oxazole?
The IUPAC name of 4,5-dimethyl-2,5-dihydro-1,2-oxazole (CID 21059269) is 4,5-dimethyl-2,5-dihydro-1,2-oxazole.
What is the SMILES notation for 4,5-dimethyl-2,5-dihydro-1,2-oxazole?
The canonical SMILES for 4,5-dimethyl-2,5-dihydro-1,2-oxazole is CC1=CNOC1C.
What is the InChIKey of 4,5-dimethyl-2,5-dihydro-1,2-oxazole?
The InChIKey is DDAFDULAOIXPJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO/c1-4-3-6-7-5(4)2/h3,5-6H,1-2H3.
What are the key properties of 4,5-dimethyl-2,5-dihydro-1,2-oxazole?
4,5-dimethyl-2,5-dihydro-1,2-oxazole has a molecular weight of 99.13 g/mol, XLogP of 0.81, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-2,5-dihydro-1,2-oxazole is sourced from PubChem (CID 21059269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).