C5H7NO — CID 143654668
4-methyl-5-methylidene-2H-1,2-oxazole (PubChem CID 143654668) has the molecular formula C5H7NO and a molecular weight of 97.12 g/mol. Its IUPAC name is 4-methyl-5-methylidene-2H-1,2-oxazole.
| Compound Name | 4-methyl-5-methylidene-2H-1,2-oxazole |
|---|---|
| PubChem CID | 143654668 |
| Molecular Formula | C5H7NO |
| Molecular Weight | 97.12 g/mol |
| Exact Mass | 97.05 |
| IUPAC Name | 4-methyl-5-methylidene-2H-1,2-oxazole |
| SMILES | C=C1ONC=C1C |
| InChI | InChI=1S/C5H7NO/c1-4-3-6-7-5(4)2/h3,6H,2H2,1H3 |
| InChIKey | IEOZPMLUPFYJEN-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 97.12 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |