C9H17NO — CID 161488495
ethane;2-methylidene-5-propan-2-yl-3H-1,3-oxazole (PubChem CID 161488495) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is ethane;2-methylidene-5-propan-2-yl-3H-1,3-oxazole.
| Compound Name | ethane;2-methylidene-5-propan-2-yl-3H-1,3-oxazole |
|---|---|
| PubChem CID | 161488495 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | ethane;2-methylidene-5-propan-2-yl-3H-1,3-oxazole |
| SMILES | C=C1NC=C(C(C)C)O1.CC |
| InChI | InChI=1S/C7H11NO.C2H6/c1-5(2)7-4-8-6(3)9-7;1-2/h4-5,8H,3H2,1-2H3;1-2H3 |
| InChIKey | WFHFLQVESMTCCG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |