About 2-methylidene-4-(2-methylpropyl)-1,3-dihydroimidazole
2-methylidene-4-(2-methylpropyl)-1,3-dihydroimidazole (PubChem CID 59871594) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is 2-methylidene-4-(2-methylpropyl)-1,3-dihydroimidazole.
Analyze 2-methylidene-4-(2-methylpropyl)-1,3-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidene-4-(2-methylpropyl)-1,3-dihydroimidazole?
The IUPAC name of 2-methylidene-4-(2-methylpropyl)-1,3-dihydroimidazole (CID 59871594) is 2-methylidene-4-(2-methylpropyl)-1,3-dihydroimidazole.
What is the SMILES notation for 2-methylidene-4-(2-methylpropyl)-1,3-dihydroimidazole?
The canonical SMILES for 2-methylidene-4-(2-methylpropyl)-1,3-dihydroimidazole is C=C1NC=C(CC(C)C)N1.
What is the InChIKey of 2-methylidene-4-(2-methylpropyl)-1,3-dihydroimidazole?
The InChIKey is GMEKWIKYPDQDKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-6(2)4-8-5-9-7(3)10-8/h5-6,9-10H,3-4H2,1-2H3.
What are the key properties of 2-methylidene-4-(2-methylpropyl)-1,3-dihydroimidazole?
2-methylidene-4-(2-methylpropyl)-1,3-dihydroimidazole has a molecular weight of 138.21 g/mol, XLogP of 1.54, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-4-(2-methylpropyl)-1,3-dihydroimidazole is sourced from PubChem (CID 59871594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).