C7H9N2Y- — CID 59952856
5-methyl-2,6-dimethylidenepyrimidin-3-ide;yttrium (PubChem CID 59952856) has the molecular formula C7H9N2Y- and a molecular weight of 210.07 g/mol. Its IUPAC name is 5-methyl-2,6-dimethylidenepyrimidin-3-ide;yttrium.
| Compound Name | 5-methyl-2,6-dimethylidenepyrimidin-3-ide;yttrium |
|---|---|
| PubChem CID | 59952856 |
| Molecular Formula | C7H9N2Y- |
| Molecular Weight | 210.07 g/mol |
| Exact Mass | 209.98 |
| IUPAC Name | 5-methyl-2,6-dimethylidenepyrimidin-3-ide;yttrium |
| SMILES | C=C1[N-]C=C(C)C(=C)N1.[Y] |
| InChI | InChI=1S/C7H9N2.Y/c1-5-4-8-7(3)9-6(5)2;/h4,9H,2-3H2,1H3;/q-1; |
| InChIKey | NQSAUWCGFSSEQN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 26.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.07 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |