C21H28N2O12P2 — CID 21059394
[[2-benzyl-4-(2,4-dioxopyrimidin-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] 2-methylpropyl hydrogen phosphate (PubChem CID 21059394) has the molecular formula C21H28N2O12P2 and a molecular weight of 562.41 g/mol. Its IUPAC name is [[2-benzyl-4-(2,4-dioxopyrimidin-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] 2-methylpropyl hydrogen phosphate.
| Compound Name | [[2-benzyl-4-(2,4-dioxopyrimidin-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] 2-methylpropyl hydrogen phosphate |
|---|---|
| PubChem CID | 21059394 |
| Molecular Formula | C21H28N2O12P2 |
| Molecular Weight | 562.41 g/mol |
| Exact Mass | 562.11 |
| IUPAC Name | [[2-benzyl-4-(2,4-dioxopyrimidin-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] 2-methylpropyl hydrogen phosphate |
| SMILES | CC(C)COP(=O)(O)OP(=O)(O)OCC1OC(n2ccc(=O)[nH]c2=O)C2OC(Cc3ccccc3)OC12 |
| InChI | InChI=1S/C21H28N2O12P2/c1-13(2)11-30-36(26,27)35-37(28,29)31-12-15-18-19(20(32-15)23-9-8-16(24)22-21(23)25)34-17(33-18)10-14-6-4-3-5-7-14/h3-9,13,15,17-20H,10-12H2,1-2H3,(H,26,27)(H,28,29)(H,22,24,25) |
| InChIKey | NWIIKHKXCPZFLT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 184.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|