C23H30N2O12P2 — CID 58714057
[[(3aS,4R,6R)-2-benzyl-4-(2,4-dioxopyrimidin-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] cyclohexyl hydrogen phosphate (PubChem CID 58714057) has the molecular formula C23H30N2O12P2 and a molecular weight of 588.44 g/mol. Its IUPAC name is [[(3aS,4R,6R)-2-benzyl-4-(2,4-dioxopyrimidin-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] cyclohexyl hydrogen phosphate.
| Compound Name | [[(3aS,4R,6R)-2-benzyl-4-(2,4-dioxopyrimidin-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] cyclohexyl hydrogen phosphate |
|---|---|
| PubChem CID | 58714057 |
| Molecular Formula | C23H30N2O12P2 |
| Molecular Weight | 588.44 g/mol |
| Exact Mass | 588.13 |
| IUPAC Name | [[(3aS,4R,6R)-2-benzyl-4-(2,4-dioxopyrimidin-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] cyclohexyl hydrogen phosphate |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OC3CCCCC3)C3OC(Cc4ccccc4)O[C@@H]32)c(=O)[nH]1 |
| InChI | InChI=1S/C23H30N2O12P2/c26-18-11-12-25(23(27)24-18)22-21-20(34-19(35-21)13-15-7-3-1-4-8-15)17(33-22)14-32-38(28,29)37-39(30,31)36-16-9-5-2-6-10-16/h1,3-4,7-8,11-12,16-17,19-22H,2,5-6,9-10,13-14H2,(H,28,29)(H,30,31)(H,24,26,27)/t17-,19?,20?,21+,22-/m1/s1 |
| InChIKey | JYHCILVHTCHXKP-XUWGEKFYSA-N |
| XLogP | 2.37 |
| TPSA | 184.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|