C36H35N2O6PS — CID 21059760
[[3-(1-hydroxyethyl)-2-[2-[4-(methylcarbamoyl)thiophen-2-yl]-2-oxoethyl]-4-oxoazetidin-1-yl]-(triphenyl-λ5-phosphanylidene)methyl] but-3-enoate (PubChem CID 21059760) has the molecular formula C36H35N2O6PS and a molecular weight of 654.73 g/mol. Its IUPAC name is [[3-(1-hydroxyethyl)-2-[2-[4-(methylcarbamoyl)thiophen-2-yl]-2-oxoethyl]-4-oxoazetidin-1-yl]-(triphenyl-λ5-phosphanylidene)methyl] but-3-enoate.
| Compound Name | [[3-(1-hydroxyethyl)-2-[2-[4-(methylcarbamoyl)thiophen-2-yl]-2-oxoethyl]-4-oxoazetidin-1-yl]-(triphenyl-λ5-phosphanylidene)methyl] but-3-enoate |
|---|---|
| PubChem CID | 21059760 |
| Molecular Formula | C36H35N2O6PS |
| Molecular Weight | 654.73 g/mol |
| Exact Mass | 654.20 |
| IUPAC Name | [[3-(1-hydroxyethyl)-2-[2-[4-(methylcarbamoyl)thiophen-2-yl]-2-oxoethyl]-4-oxoazetidin-1-yl]-(triphenyl-λ5-phosphanylidene)methyl] but-3-enoate |
| SMILES | C=CCC(=O)OC(N1C(=O)C(C(C)O)C1CC(=O)c1cc(C(=O)NC)cs1)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H35N2O6PS/c1-4-14-32(41)44-36(38-29(33(24(2)39)35(38)43)22-30(40)31-21-25(23-46-31)34(42)37-3)45(26-15-8-5-9-16-26,27-17-10-6-11-18-27)28-19-12-7-13-20-28/h4-13,15-21,23-24,29,33,39H,1,14,22H2,2-3H3,(H,37,42) |
| InChIKey | QHVPYIKNHYALFF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.73 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|