C10H11N — CID 21060901
N,4-bis(ethenyl)aniline (PubChem CID 21060901) has the molecular formula C10H11N and a molecular weight of 145.20 g/mol. Its IUPAC name is N,4-bis(ethenyl)aniline.
| Compound Name | N,4-bis(ethenyl)aniline |
|---|---|
| PubChem CID | 21060901 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | N,4-bis(ethenyl)aniline |
| SMILES | C=CNc1ccc(C=C)cc1 |
| InChI | InChI=1S/C10H11N/c1-3-9-5-7-10(8-6-9)11-4-2/h3-8,11H,1-2H2 |
| InChIKey | BRYTZWXGSXYIDJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |