About 3-acetyl-5-(1,3-oxazol-2-yl)-N,N-dipropylbenzamide
3-acetyl-5-(1,3-oxazol-2-yl)-N,N-dipropylbenzamide (PubChem CID 21062892) has the molecular formula C18H22N2O3
and a molecular weight of 314.39 g/mol. Its IUPAC name is 3-acetyl-5-(1,3-oxazol-2-yl)-N,N-dipropylbenzamide.
Molecular Properties
| Compound Name | 3-acetyl-5-(1,3-oxazol-2-yl)-N,N-dipropylbenzamide |
| PubChem CID | 21062892 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 3-acetyl-5-(1,3-oxazol-2-yl)-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C(C)=O)cc(-c2ncco2)c1 |
| InChI | InChI=1S/C18H22N2O3/c1-4-7-20(8-5-2)18(22)16-11-14(13(3)21)10-15(12-16)17-19-6-9-23-17/h6,9-12H,4-5,7-8H2,1-3H3 |
| InChIKey | VKQMQFMVMBQRKM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-acetyl-5-(1,3-oxazol-2-yl)-N,N-dipropylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-5-(1,3-oxazol-2-yl)-N,N-dipropylbenzamide?
The IUPAC name of 3-acetyl-5-(1,3-oxazol-2-yl)-N,N-dipropylbenzamide (CID 21062892) is 3-acetyl-5-(1,3-oxazol-2-yl)-N,N-dipropylbenzamide.
What is the SMILES notation for 3-acetyl-5-(1,3-oxazol-2-yl)-N,N-dipropylbenzamide?
The canonical SMILES for 3-acetyl-5-(1,3-oxazol-2-yl)-N,N-dipropylbenzamide is CCCN(CCC)C(=O)c1cc(C(C)=O)cc(-c2ncco2)c1.
What is the InChIKey of 3-acetyl-5-(1,3-oxazol-2-yl)-N,N-dipropylbenzamide?
The InChIKey is VKQMQFMVMBQRKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O3/c1-4-7-20(8-5-2)18(22)16-11-14(13(3)21)10-15(12-16)17-19-6-9-23-17/h6,9-12H,4-5,7-8H2,1-3H3.
What are the key properties of 3-acetyl-5-(1,3-oxazol-2-yl)-N,N-dipropylbenzamide?
3-acetyl-5-(1,3-oxazol-2-yl)-N,N-dipropylbenzamide has a molecular weight of 314.39 g/mol, XLogP of 3.81, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-5-(1,3-oxazol-2-yl)-N,N-dipropylbenzamide is sourced from PubChem (CID 21062892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).