C19H23N3O2 — CID 21086057
3-N,3-N-dipropyl-5-pyridin-3-ylbenzene-1,3-dicarboxamide (PubChem CID 21086057) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 3-N,3-N-dipropyl-5-pyridin-3-ylbenzene-1,3-dicarboxamide.
| Compound Name | 3-N,3-N-dipropyl-5-pyridin-3-ylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 21086057 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 3-N,3-N-dipropyl-5-pyridin-3-ylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C(N)=O)cc(-c2cccnc2)c1 |
| InChI | InChI=1S/C19H23N3O2/c1-3-8-22(9-4-2)19(24)17-11-15(10-16(12-17)18(20)23)14-6-5-7-21-13-14/h5-7,10-13H,3-4,8-9H2,1-2H3,(H2,20,23) |
| InChIKey | BCDHLRPRJJSIJK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |