C15H20N2O3 — CID 142195355
5-formyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 142195355) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 5-formyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 5-formyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 142195355 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 5-formyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C=O)cc(C(N)=O)c1 |
| InChI | InChI=1S/C15H20N2O3/c1-3-5-17(6-4-2)15(20)13-8-11(10-18)7-12(9-13)14(16)19/h7-10H,3-6H2,1-2H3,(H2,16,19) |
| InChIKey | XUCMURYIKKWMEL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|