C18H28N4O3 — CID 150645845
5-(hydrazinecarbonyl)-3-N,3-N,4-tripropylbenzene-1,3-dicarboxamide (PubChem CID 150645845) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is 5-(hydrazinecarbonyl)-3-N,3-N,4-tripropylbenzene-1,3-dicarboxamide.
| Compound Name | 5-(hydrazinecarbonyl)-3-N,3-N,4-tripropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 150645845 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 5-(hydrazinecarbonyl)-3-N,3-N,4-tripropylbenzene-1,3-dicarboxamide |
| SMILES | CCCc1c(C(=O)NN)cc(C(N)=O)cc1C(=O)N(CCC)CCC |
| InChI | InChI=1S/C18H28N4O3/c1-4-7-13-14(17(24)21-20)10-12(16(19)23)11-15(13)18(25)22(8-5-2)9-6-3/h10-11H,4-9,20H2,1-3H3,(H2,19,23)(H,21,24) |
| InChIKey | JAWBCPUBHXDTEQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|