C12H10Cl2N4O4S — CID 2106745
2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(4-sulfamoylphenyl)acetamide (PubChem CID 2106745) has the molecular formula C12H10Cl2N4O4S and a molecular weight of 377.21 g/mol. Its IUPAC name is 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 2106745 |
| Molecular Formula | C12H10Cl2N4O4S |
| Molecular Weight | 377.21 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)Cn2ncc(Cl)c(Cl)c2=O)cc1 |
| InChI | InChI=1S/C12H10Cl2N4O4S/c13-9-5-16-18(12(20)11(9)14)6-10(19)17-7-1-3-8(4-2-7)23(15,21)22/h1-5H,6H2,(H,17,19)(H2,15,21,22) |
| InChIKey | XVPCSDSVLRDRNR-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.21 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |