C14H13Cl2N3O2 — CID 3647379
2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(3-ethylphenyl)acetamide (PubChem CID 3647379) has the molecular formula C14H13Cl2N3O2 and a molecular weight of 326.18 g/mol. Its IUPAC name is 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(3-ethylphenyl)acetamide.
| Compound Name | 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(3-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 3647379 |
| Molecular Formula | C14H13Cl2N3O2 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(3-ethylphenyl)acetamide |
| SMILES | CCc1cccc(NC(=O)Cn2ncc(Cl)c(Cl)c2=O)c1 |
| InChI | InChI=1S/C14H13Cl2N3O2/c1-2-9-4-3-5-10(6-9)18-12(20)8-19-14(21)13(16)11(15)7-17-19/h3-7H,2,8H2,1H3,(H,18,20) |
| InChIKey | XSUCMWYIJGRMPK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |