C17H27N3O4S — CID 21068643
2-[4-(4-ethyl-2-methylphenyl)piperazin-1-yl]sulfonyl-N-hydroxy-2-methylpropanamide (PubChem CID 21068643) has the molecular formula C17H27N3O4S and a molecular weight of 369.49 g/mol. Its IUPAC name is 2-[4-(4-ethyl-2-methylphenyl)piperazin-1-yl]sulfonyl-N-hydroxy-2-methylpropanamide.
| Compound Name | 2-[4-(4-ethyl-2-methylphenyl)piperazin-1-yl]sulfonyl-N-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 21068643 |
| Molecular Formula | C17H27N3O4S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-[4-(4-ethyl-2-methylphenyl)piperazin-1-yl]sulfonyl-N-hydroxy-2-methylpropanamide |
| SMILES | CCc1ccc(N2CCN(S(=O)(=O)C(C)(C)C(=O)NO)CC2)c(C)c1 |
| InChI | InChI=1S/C17H27N3O4S/c1-5-14-6-7-15(13(2)12-14)19-8-10-20(11-9-19)25(23,24)17(3,4)16(21)18-22/h6-7,12,22H,5,8-11H2,1-4H3,(H,18,21) |
| InChIKey | YVNYYPLKZFIVTN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|