C15H16FN3O2S — CID 21070580
(4-amino-2-ethylsulfanylpyrimidin-5-yl)-(3-fluoro-6-methoxy-2-methylphenyl)methanone (PubChem CID 21070580) has the molecular formula C15H16FN3O2S and a molecular weight of 321.38 g/mol. Its IUPAC name is (4-amino-2-ethylsulfanylpyrimidin-5-yl)-(3-fluoro-6-methoxy-2-methylphenyl)methanone.
| Compound Name | (4-amino-2-ethylsulfanylpyrimidin-5-yl)-(3-fluoro-6-methoxy-2-methylphenyl)methanone |
|---|---|
| PubChem CID | 21070580 |
| Molecular Formula | C15H16FN3O2S |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | (4-amino-2-ethylsulfanylpyrimidin-5-yl)-(3-fluoro-6-methoxy-2-methylphenyl)methanone |
| SMILES | CCSc1ncc(C(=O)c2c(OC)ccc(F)c2C)c(N)n1 |
| InChI | InChI=1S/C15H16FN3O2S/c1-4-22-15-18-7-9(14(17)19-15)13(20)12-8(2)10(16)5-6-11(12)21-3/h5-7H,4H2,1-3H3,(H2,17,18,19) |
| InChIKey | NHWHZLASUQJLGV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |