C13H9ClF2N2O2 — CID 58590826
(2-amino-6-chloro-3-pyridinyl)-(2,3-difluoro-6-methoxyphenyl)methanone (PubChem CID 58590826) has the molecular formula C13H9ClF2N2O2 and a molecular weight of 298.68 g/mol. Its IUPAC name is (2-amino-6-chloro-3-pyridinyl)-(2,3-difluoro-6-methoxyphenyl)methanone.
| Compound Name | (2-amino-6-chloro-3-pyridinyl)-(2,3-difluoro-6-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 58590826 |
| Molecular Formula | C13H9ClF2N2O2 |
| Molecular Weight | 298.68 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | (2-amino-6-chloro-3-pyridinyl)-(2,3-difluoro-6-methoxyphenyl)methanone |
| SMILES | COc1ccc(F)c(F)c1C(=O)c1ccc(Cl)nc1N |
| InChI | InChI=1S/C13H9ClF2N2O2/c1-20-8-4-3-7(15)11(16)10(8)12(19)6-2-5-9(14)18-13(6)17/h2-5H,1H3,(H2,17,18) |
| InChIKey | CIGARVBMXIABLP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.68 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|