C13H14N4O3S — CID 21070598
(4-amino-2-ethylsulfinylpyrimidin-5-yl)-(3-methoxy-2-pyridinyl)methanone (PubChem CID 21070598) has the molecular formula C13H14N4O3S and a molecular weight of 306.35 g/mol. Its IUPAC name is (4-amino-2-ethylsulfinylpyrimidin-5-yl)-(3-methoxy-2-pyridinyl)methanone.
| Compound Name | (4-amino-2-ethylsulfinylpyrimidin-5-yl)-(3-methoxy-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 21070598 |
| Molecular Formula | C13H14N4O3S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | (4-amino-2-ethylsulfinylpyrimidin-5-yl)-(3-methoxy-2-pyridinyl)methanone |
| SMILES | CCS(=O)c1ncc(C(=O)c2ncccc2OC)c(N)n1 |
| InChI | InChI=1S/C13H14N4O3S/c1-3-21(19)13-16-7-8(12(14)17-13)11(18)10-9(20-2)5-4-6-15-10/h4-7H,3H2,1-2H3,(H2,14,16,17) |
| InChIKey | OYWMYXFOKNNAHL-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |