C10H9F3O2 — CID 21071549
3-(1,2,3-trifluoropropoxy)benzaldehyde (PubChem CID 21071549) has the molecular formula C10H9F3O2 and a molecular weight of 218.17 g/mol. Its IUPAC name is 3-(1,2,3-trifluoropropoxy)benzaldehyde.
| Compound Name | 3-(1,2,3-trifluoropropoxy)benzaldehyde |
|---|---|
| PubChem CID | 21071549 |
| Molecular Formula | C10H9F3O2 |
| Molecular Weight | 218.17 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 3-(1,2,3-trifluoropropoxy)benzaldehyde |
| SMILES | O=Cc1cccc(OC(F)C(F)CF)c1 |
| InChI | InChI=1S/C10H9F3O2/c11-5-9(12)10(13)15-8-3-1-2-7(4-8)6-14/h1-4,6,9-10H,5H2 |
| InChIKey | ITEFIUCINCAGGJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.17 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|